Per- and polyfluorinated alkyl substances (PFAS) have been used abundantly since
their inception in the twentieth century and have become a closely monitored class of
compounds within environmental testing. This application note outlines a procedure for
those seeking to follow DIN 38407-42 for large volumes of water. The data presented
was generated using a Biotage® VacMaster™ vacuum manifold with a PFAS free Biotage®
VacMaster™ Large Volume Extraction (LVE) kit in conjunction with EVOLUTE® PFAS SPE
columns and a TurboVap® LV system.
|
Target Analyte |
Acronym |
CAS |
|
Perfluorobutanoic acid |
PFBA |
375-22-4 |
|
Perfluoropentanoic acid |
PFPeA |
2706-90-3 |
|
Perfluorohexanoic acid |
PFHxA |
307-24-4 |
|
Perfluoroheptanoic acid |
PFHpA |
375-85-9 |
|
Perfluorooctanoic acid |
PFOA |
335-67-1 |
|
Perfluorononanoic acid |
PFNA |
375-95-1 |
|
Perfluorodecanoic acid |
PFDA |
335-76-2 |
|
Perfluorobutanesulfonic acid |
PFBS |
375-73-5 |
|
Perfluorohexanesulfonic acid |
PFHxS |
355-46-4 |
|
Perfluorooctanesulfonic acid |
PFOS |
1763-23-1 |
|
Perfluoroundecanoic acid1 |
PFUnA |
2058-94-8 |
|
Perfluorododecanoic acid1 |
PFDoA |
307-55-1 |
|
Perfluoroheptanesulfonic acid1 |
PFHpS |
375-92-8 |
|
Perfluorodecanesulfonic acid1 |
PFDS |
335-77-3 |
|
1H,1H,2H,2H-perfluorooctanesulfonic acid1 |
H4PFOS |
27619-97-2 |
|
Internal Standard |
|
|
|
Perfluoro-n-[1,2,3,4-13C4]butanoic acid |
13C4-PFBA |
|
|
Perfluoro-n-[1,2,3,4,5-13C5]pentanoic acid |
13C5-PFPeA |
|
|
Perfluoro-n-[1,2-13C2]hexanoic acid |
13C2-PFHxA |
|
|
Sodium perfluoro-1-[1,2,3-13C3]hexanesulfonate |
13C3-PFHxS |
|
|
Sodium perfluoro-1-[1,2,3-18O2]hexanesulfonate |
18O2-PFHxS |
|
|
Perfluoro-n-[1,2,3,4-13C4]heptanoic acid |
13C4-PFHpA |
|
|
Perfluoro-[1,2-13C4]octanoic acid |
13C4-PFOA |
|
|
Sodium perfluoro-1-[1,2,3,4-13C4]octanesulfonate |
13C4-PFOS |
|
|
Perfluoro-n-[13C5]nonanoic acid |
13C5-PFNA |
|
|
Perfluoro-n-[1,2-13C2]decanoic acid |
13C2-PFDA |
|
1. Add 400 μL of NH4OH for every 100 mL of methanol to a clean beaker.
2. Agitate to homogenize.
3. Prepare new solution daily.
1. Measure out 499.5 mL of reagent water in a clean beaker.
2. Add 0.193 g of NH4Ac.
3. Sonicate the solution for 5 minutes until the salt is fully dissolved.
4. Add 570 μL of glacial acetic acid.
5. Agitate to homogenize the solution.
1. Dilute 100 μL of the native stock solution with 900 μL of methanol to achieve a 10 ppt solution.
EVOLUTE® PFAS 500 mg/6 mL or EVOLUTE® PFAS 150 mg/6 mL
Adjust the pH of each sample to 3 using glacial acetic acid. Add targets and internal standards.
Condition each cartridge with 0.1 % NH4OH in methanol (10 mL) followed by methanol (10 mL).
Equilibrate each cartridge with reagent water (10 mL).
Load sample at a flow rate of 5 mL/min.
Rinse the sample container with acetate buffer solution (10 mL) and load onto the cartridge. Repeat using reagent water (10 mL).
Dry the cartridge for 5 minutes at a flow rate of 5 mL/min.
Rinse the sample container with methanol (5 mL) and use to elute the analytes from the cartridge at a flow rate of 2 mL/min. Repeat using 0.1 % NH4OH in methanol (5 mL).
Concentrate the extract to a volume of 1 mL. Add IS and mix prior to analysis.
Note: EVOLUTE® PFAS 60 mg/3 mL cartridges may be used however sample and solvent volumes should be adjusted. Refer to DIN 38407-42 for the appropriate amounts.
Bath Temp: 60 ˚C
Evaporation Mode Method (Ramp Gradient)
Manifold Setup 48 positions
Rack Row Height 120 mm*
Step 1: 1.5 L/min for 20 min
Step 2: 3.0 L/min for 15 min
Step 3: 3.5 L/min for 45 min
*The nozzle position was adjusted such that it was as far to the right as possible to give the user a clear view of the vortex within the tube.
» 1290 Infinity II Multicartridge Thermostat, G7116B
» 1290 Infinity II Multisampler, G7167B
» 1290 Infinity II High Speed Pump, G7120A
» InfinityLab PFC-free HPLC Conversion Kit, 5004-0006
» InfinityLab PFC Delay Cartridge, 4.6 x 30 mm, p/n 5062-8100
» ZORBAX RRHD Eclipse Plus C18, 95 Å, 22.1 x 50 mm, 1.8 µm, p/n 959757-902
» A: 20 mM Ammonium Acetate in Water
» B: Methanol
|
Time (min) |
%A |
%B |
|
0.50 |
95.00 |
5.00 |
|
3.00 |
60.00 |
40.00 |
|
16.00 |
20.00 |
80.00 |
|
18.00 |
20.00 |
80.00 |
|
20.00 |
5.00 |
95.00 |
|
20.50 |
0.00 |
100.00 |
|
25.00 |
0.00 |
100.00 |
|
26.00 |
5.00 |
95.00 |
» Flow Rate: 0.2 mL/min
» Injection Volume: 5 μL
» Cartridge Temperature: 50 ˚C
» Gas Temperature: 230 ˚C
» Gas Flow: 4 L/min
» Nebulizer: 20 psi
» Sheath Gas Temperature: 375 ˚C
» Sheath Gas Flow: 12 L/min
» Capillary Voltage (Positive): 3500 V
» Capillary Voltage (Negative): 3500 V
» Nozzle Voltage (Positive): 500 V
» Nozzle Voltage (Negative): 0 V
For a complete listing of MRM Transitions, see Appendix B
For the work being done here, a total of six points were used in the calibration covering a range of 0.2-20 ppt in the sample. The lowest three points were below the calculated MRL. The curve was forced through zero and achieved excellent linearity across the calibration range.
PFBS
PFHxS
Figure 1. Calibration curves for PFBS and PFHxS. Calibration curves for the remaining target analytes in Table 1 are shown in Appendix C.
A target MRL of 2 ng/L was selected and at least seven replicate laboratory fortified blanks (LFBs) were created and run at that concentration. Figure 2 below illustrates the results of this test for both the 150 mg and 500 mg cartridges using 250 mL sample volumes; all compounds were recovered within 15% of the spiked amount and had less than 10% CV.
Figure 2. MRL and DL Recoveries. Those compounds with an asterisk were used in salt form.
The data for individual compounds is shown in Appendix D.
An investigation into the background of the complete process was done in three steps. The first step was to run blank injections of methanol on the analytical system (system blank). The second step was to load centrifuge tubes containing a similar volume of methanol as would result from the extraction process onto the evaporation system, allowing them to concentrate and then run on the analytical system (evaporation blank). The third and final step was to create a full Laboratory Reagent Blank (LRB), extract and concentrate it, and run it on the analytical system. By separating the process into three steps it becomes easier to determine what, if any, contribution to the overall background each of the steps has. The result of these tests are given in Appendix E and selected data are shown below in Figures 3–5.
Figure 3. Contribution of the TurboVap® LV to the PFAS Background. Those compounds with an asterisk were used in salt form.
Figure 4. PFAS Background for full LRB using EVOLUTE® PFAS 500 mg/6 mL cartridges. Those compounds with an asterisk were used in salt form.
Figure 5. PFAS Background for full LRB using EVOLUTE® PFAS 150 mg/6 mL cartridges. Those compounds with an asterisk were used in salt form.
For those results which were generated using only the analytical system, all target analytes were N.D. (unable to be separated from the noise in the baseline) and so were not listed out in the previous tables.
When examining the data resulting for both the TurboVap® LV and the full LRB tests (which includes the Biotage® VacMaster™ manifold, PFAS Free Large Volume Loading Kit, and the EVOLUTE® cartridges as well as the TurboVap® LV) there are clear indications of the presence of a PFAS background. However, even at the highest concentrations detected, all levels are much lower than the 1/3 MRL limit indicating that the background is acceptable and will not interfere with future sample runs.
To determine the precision and accuracy of the sample preparation process, four LFB samples were prepared at concentrations of 15 ppt. The data is given in Appendix F and illustrated in Figures 6 and 7.
Figure 6. Initial Demonstration of Accuracy (15 ng/L, n=4). Those compounds with an asterisk were used in salt form.
Figure 7. Initial Demonstration of Precision (15 ng/L, n=4). Those compounds with an asterisk were used in salt form.
The results show that the average recovery for each target analyte was within 15% of the nominal value and that the coefficient of variation (CV) for each analyte fell under 10% on average.
To simulate an influent sample, four LFB samples were created with concentrations which were above the range of the calibration curve. These samples were extracted, and the clean up procedure given in Appendix A was run three times. To ensure that the system background was adequately reduced, a set of four LRB samples were extracted immediately afterwards and analysed. The LRB data is presented in Appendix G and illustrated in Figure 8.
Figure 8. Results of carryover study following four, 50 ng/L LFB samples using EVOLUTE® PFAS 500 mg/6 mL cartridges. Those compounds with an asterisk were used in salt form.
The graph shown in Figure 8 shows a clear indication that the cleaning procedure in Appendix A was successful in reducing the background of PFAS compounds to below the 1/3 MRL limit. For further reductions in the background, additional cleaning steps could be employed.
With the scrutiny being given to the presence of PFAS compounds in the environment, it is essential to find reliable products which can meet the requirements of DIN 38407-42. This application note has shown that the VacMaster™ vacuum manifold with PFAS free accessories, EVOLUTE® PFAS SPE cartridges and the TurboVap® LV can be used to easily meet and exceed the demands of the method.
|
Part Number |
Description |
Qty |
|
121-2015ML |
Biotage® VacMaster™ 20 Sample Processing Station With 15 mm Rack |
1 |
|
121-2190 |
Biotage® VacMaster™ LVE Kit (PFAS) for 1, 3, 6 mL SPE Cartridges |
1 |
|
121-0009-PP |
Polypropylene (PFAS) Stopcocks |
10 |
|
614-0050-CP |
EVOLUTE® PFAS 500 mg/6 mL cartridges |
30 |
|
614-0015-CP |
EVOLUTE® PFAS 150 mg/6 mL cartridges |
30 |
|
614-0006-BP |
EVOLUTE® PFAS 60 mg/3 mL cartridges |
50 |
|
415000 |
TurboVap® LV Automated Solvent Evaporation System |
1 |
|
414964 |
TurboVap® LV Multi Rack (48 Positions, 10–20 mm Tubes) |
1 |
For the best results, it is recommended that this procedure be completed before the use of the VacMaster™ each day and at the end of each extraction prior to proceeding with the next set of samples.
Note: In situations where the previous sample was highly concentrated, the above cleaning procedure may need to be repeated multiple times. If there is concern regarding potential carryover contamination regardless of the cleaning procedure, a laboratory reagent blank should be run in that position to ensure its cleanliness.
|
Cpd Name |
ISTD? |
Prec Ion |
MS1 Res |
Prod Ion |
MS2 Res |
Frag (V) |
CE (V) |
Cell Acc (V) |
Ret Time (min) |
Ret Window |
Polarity |
|
H4PFOS |
No |
427 |
Unit/Enh (6490) |
406.8 |
Unit/Enh (6490) |
125 |
24 |
5 |
13.3 |
1.37 |
Negative |
|
H4PFOS |
No |
427 |
Unit/Enh (6490) |
80.9 |
Unit/Enh (6490) |
125 |
40 |
5 |
13.3 |
1.37 |
Negative |
|
C3-PFHxS |
No |
402 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
49 |
5 |
11.7 |
1.5 |
Negative |
|
C4-PFBA |
No |
217 |
Unit/Enh (6490) |
172 |
Unit/Enh (6490) |
60 |
8 |
5 |
5.1 |
1.45 |
Negative |
|
C4-PFHpA |
No |
367 |
Unit/Enh (6490) |
322 |
Unit/Enh (6490) |
72 |
0 |
5 |
11.6 |
1.2 |
Negative |
|
C5-PFHxA |
No |
318 |
Unit/Enh (6490) |
273 |
Unit/Enh (6490) |
70 |
8 |
5 |
9.7 |
1.14 |
Negative |
|
C5-PFPeA |
No |
268 |
Unit/Enh (6490) |
223 |
Unit/Enh (6490) |
60 |
20 |
5 |
7.4 |
1.55 |
Negative |
|
C6-PFDA |
No |
519 |
Unit/Enh (6490) |
474 |
Unit/Enh (6490) |
81 |
4 |
5 |
16.2 |
1.65 |
Negative |
|
C8-PFOA |
No |
421 |
Unit/Enh (6490) |
376 |
Unit/Enh (6490) |
80 |
8 |
5 |
13.4 |
1.38 |
Negative |
|
C8-PFOS |
No |
507 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
50 |
5 |
15 |
1.53 |
Negative |
|
C9-PFNA |
No |
472 |
Unit/Enh (6490) |
427 |
Unit/Enh (6490) |
66 |
4 |
5 |
14.9 |
1.52 |
Negative |
|
PFBA |
No |
213 |
Unit/Enh (6490) |
168.9 |
Unit/Enh (6490) |
60 |
8 |
5 |
5.1 |
1.48 |
Negative |
|
PFBS |
No |
298.9 |
Unit/Enh (6490) |
98.9 |
Unit/Enh (6490) |
100 |
29 |
5 |
7.9 |
1.41 |
Negative |
|
PFBS |
No |
298.9 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
45 |
5 |
7.9 |
1.41 |
Negative |
|
PFDA |
No |
513 |
Unit/Enh (6490) |
469 |
Unit/Enh (6490) |
81 |
4 |
5 |
16.2 |
1.65 |
Negative |
|
PFDA |
No |
513 |
Unit/Enh (6490) |
218.7 |
Unit/Enh (6490) |
100 |
16 |
5 |
16.2 |
1.65 |
Negative |
|
PFDoA |
No |
613 |
Unit/Enh (6490) |
569 |
Unit/Enh (6490) |
79 |
5 |
5 |
18.2 |
1.84 |
Negative |
|
PFDoA |
No |
613 |
Unit/Enh (6490) |
268.7 |
Unit/Enh (6490) |
100 |
20 |
5 |
18.2 |
1.84 |
Negative |
|
PFDS |
No |
599 |
Unit/Enh (6490) |
99 |
Unit/Enh (6490) |
100 |
40 |
5 |
17.15 |
1.75 |
Negative |
|
PFDS |
No |
599 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
40 |
5 |
17.15 |
1.75 |
Negative |
|
PFHpA |
No |
362.9 |
Unit/Enh (6490) |
319 |
Unit/Enh (6490) |
72 |
0 |
5 |
11.6 |
1.2 |
Negative |
|
PFHpA |
No |
362.9 |
Unit/Enh (6490) |
169 |
Unit/Enh (6490) |
72 |
12 |
5 |
11.6 |
1.2 |
Negative |
|
PFHpS |
No |
448.9 |
Unit/Enh (6490) |
98.7 |
Unit/Enh (6490) |
100 |
44 |
5 |
13.5 |
1.39 |
Negative |
|
PFHpS |
No |
448.9 |
Unit/Enh (6490) |
79.7 |
Unit/Enh (6490) |
100 |
52 |
5 |
13.5 |
1.39 |
Negative |
|
PFHxA |
No |
313 |
Unit/Enh (6490) |
268.9 |
Unit/Enh (6490) |
70 |
8 |
5 |
9.7 |
1.12 |
Negative |
|
PFHxA |
No |
313 |
Unit/Enh (6490) |
119 |
Unit/Enh (6490) |
70 |
18 |
5 |
9.7 |
1.12 |
Negative |
|
PFHxS |
No |
398.9 |
Unit/Enh (6490) |
99 |
Unit/Enh (6490) |
100 |
45 |
5 |
11.7 |
1.5 |
Negative |
|
PFHxS |
No |
398.9 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
49 |
5 |
11.7 |
1.5 |
Negative |
|
PFNA |
No |
463 |
Unit/Enh (6490) |
419 |
Unit/Enh (6490) |
66 |
4 |
5 |
14.9 |
1.52 |
Negative |
|
PFNA |
No |
463 |
Unit/Enh (6490) |
219 |
Unit/Enh (6490) |
66 |
17 |
5 |
14.9 |
1.52 |
Negative |
|
PFOA |
No |
413 |
Unit/Enh (6490) |
369 |
Unit/Enh (6490) |
69 |
4 |
5 |
13.4 |
1.38 |
Negative |
|
PFOA |
No |
413 |
Unit/Enh (6490) |
169 |
Unit/Enh (6490) |
69 |
12 |
5 |
13.4 |
1.38 |
Negative |
|
PFOS |
No |
498.9 |
Unit/Enh (6490) |
99 |
Unit/Enh (6490) |
100 |
50 |
5 |
15 |
1.53 |
Negative |
|
PFOS |
No |
498.9 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
50 |
5 |
15 |
1.53 |
Negative |
|
PFPeA |
No |
263 |
Unit/Enh (6490) |
218.9 |
Unit/Enh (6490) |
60 |
8 |
5 |
7.4 |
1.77 |
Negative |
|
PFUnA |
No |
563 |
Unit/Enh (6490) |
519 |
Unit/Enh (6490) |
73 |
5 |
5 |
17.2 |
1.75 |
Negative |
|
PFUnA |
No |
563 |
Unit/Enh (6490) |
269 |
Unit/Enh (6490) |
100 |
20 |
5 |
17.2 |
1.75 |
Negative |
Figure 9. Calibration curves for the target analytes in Table 1, covering a concentration range of 0.2-20 ppt.
|
|
Conc. (ng/L) |
1 (ng/L) |
2 (ng/L) |
3 (ng/L) |
4 (ng/L) |
5 (ng/L) |
6 (ng/L) |
7 (ng/L) |
x̅ (ng/L) |
x̅ (%) |
s (ng/L) |
CV (%) |
DL (ng/L) |
|
PFBA* |
1.77 |
1.67 |
1.71 |
1.67 |
1.68 |
1.81 |
1.60 |
1.80 |
1.71 |
96 |
0.08 |
4.43 |
0.24 |
|
PFPeA |
2.00 |
1.85 |
1.83 |
1.92 |
1.97 |
1.88 |
1.75 |
1.91 |
1.87 |
94 |
0.07 |
3.81 |
0.22 |
|
PFBS |
2.00 |
1.73 |
1.90 |
1.82 |
1.70 |
1.73 |
1.65 |
1.95 |
1.78 |
89 |
0.11 |
6.12 |
0.34 |
|
PFHxA |
2.00 |
1.80 |
1.92 |
1.89 |
1.80 |
1.98 |
1.75 |
1.92 |
1.87 |
93 |
0.08 |
4.50 |
0.26 |
|
PFHpA |
2.00 |
1.96 |
2.06 |
2.04 |
1.94 |
2.01 |
1.80 |
2.08 |
1.99 |
99 |
0.09 |
4.75 |
0.30 |
|
PFHxS* |
1.90 |
1.85 |
1.78 |
1.77 |
1.70 |
1.82 |
1.73 |
1.77 |
1.77 |
94 |
0.05 |
2.84 |
0.16 |
|
PFHpS* |
1.91 |
1.90 |
1.90 |
1.86 |
1.65 |
1.92 |
1.51 |
1.73 |
1.78 |
93 |
0.16 |
8.79 |
0.49 |
|
H4PFOS* |
1.90 |
1.80 |
1.87 |
1.88 |
1.86 |
1.87 |
1.68 |
1.86 |
1.83 |
96 |
0.07 |
4.02 |
0.23 |
|
PFOA |
2.00 |
1.80 |
1.86 |
1.93 |
1.91 |
1.94 |
1.67 |
1.94 |
1.86 |
93 |
0.10 |
5.34 |
0.31 |
|
PFOS* |
1.92 |
1.96 |
1.89 |
1.79 |
1.89 |
1.92 |
1.69 |
1.89 |
1.86 |
97 |
0.09 |
4.98 |
0.29 |
|
PFNA |
2.00 |
1.88 |
1.92 |
1.95 |
1.90 |
1.94 |
1.79 |
2.07 |
1.92 |
96 |
0.08 |
4.30 |
0.26 |
|
PFDA |
2.00 |
1.87 |
1.89 |
1.87 |
1.83 |
2.01 |
1.79 |
2.01 |
1.89 |
95 |
0.09 |
4.55 |
0.27 |
|
PFDS |
2.00 |
2.10 |
2.06 |
1.95 |
2.14 |
1.70 |
1.64 |
1.93 |
1.93 |
97 |
0.19 |
9.98 |
0.61 |
|
PFUnA |
2.00 |
1.89 |
1.91 |
1.90 |
1.81 |
1.88 |
1.75 |
1.94 |
1.87 |
93 |
0.07 |
3.51 |
0.21 |
|
PFDoA |
2.00 |
1.85 |
1.96 |
1.96 |
1.81 |
2.00 |
1.75 |
1.96 |
1.90 |
95 |
0.10 |
5.04 |
0.30 |
*Analytes were used in salt form and calculated concentrations were corrected to compensate where needed.
|
|
Conc. (ng/L) |
1 (ng/L) |
2 (ng/L) |
3 (ng/L) |
4 (ng/L) |
5 (ng/L) |
6 (ng/L) |
7 (ng/L) |
8 (ng/L) |
x̅ (ng/L) |
x̅ (%) |
s (ng/L) |
CV (%) |
DL (ng/L) |
|
PFBA* |
1.77 |
1.88 |
1.83 |
1.87 |
1.94 |
1.83 |
1.86 |
1.79 |
1.83 |
1.85 |
104 |
0.05 |
2.56 |
0.14 |
|
PFPeA |
2.00 |
1.96 |
1.92 |
1.96 |
2.05 |
1.97 |
1.93 |
1.86 |
1.96 |
1.95 |
98 |
0.05 |
2.79 |
0.16 |
|
PFBS |
2.00 |
1.87 |
1.76 |
1.84 |
1.73 |
1.77 |
1.81 |
1.73 |
1.75 |
1.78 |
89 |
0.05 |
2.83 |
0.15 |
|
PFHxA |
2.00 |
2.09 |
2.00 |
2.04 |
2.10 |
2.03 |
2.09 |
1.98 |
2.08 |
2.05 |
103 |
0.05 |
2.20 |
0.14 |
|
PFHpA |
2.00 |
2.08 |
1.96 |
1.98 |
1.91 |
2.04 |
1.95 |
2.01 |
2.01 |
1.99 |
100 |
0.06 |
2.76 |
0.17 |
|
PFHxS* |
1.90 |
1.75 |
1.83 |
1.80 |
1.85 |
1.66 |
1.74 |
1.77 |
1.74 |
1.77 |
93 |
0.06 |
3.34 |
0.18 |
|
PFHpS* |
1.91 |
1.77 |
1.78 |
1.85 |
1.79 |
1.64 |
1.66 |
1.69 |
1.64 |
1.73 |
91 |
0.08 |
4.69 |
0.24 |
|
H4PFOS* |
1.90 |
1.91 |
1.84 |
1.97 |
1.92 |
2.05 |
2.06 |
2.01 |
2.11 |
1.98 |
104 |
0.09 |
4.58 |
0.27 |
|
PFOA |
2.00 |
1.96 |
1.99 |
2.01 |
2.08 |
1.97 |
2.05 |
1.91 |
1.97 |
1.99 |
100 |
0.05 |
2.59 |
0.15 |
|
PFOS* |
1.92 |
2.00 |
1.89 |
1.93 |
2.01 |
1.95 |
1.95 |
1.98 |
1.96 |
1.96 |
102 |
0.04 |
1.99 |
0.12 |
|
PFNA |
2.00 |
2.08 |
1.94 |
2.02 |
2.01 |
2.04 |
2.08 |
2.11 |
2.02 |
2.03 |
102 |
0.05 |
2.59 |
0.16 |
|
PFDA |
2.00 |
1.99 |
1.89 |
1.96 |
1.99 |
1.91 |
2.03 |
2.07 |
2.04 |
1.98 |
99 |
0.06 |
3.12 |
0.19 |
|
PFDS |
2.00 |
1.92 |
2.08 |
1.81 |
2.04 |
2.01 |
1.93 |
2.04 |
1.90 |
1.97 |
98 |
0.09 |
4.61 |
0.27 |
|
PFUnA |
2.00 |
2.09 |
1.97 |
1.93 |
1.95 |
1.89 |
1.97 |
1.95 |
1.98 |
1.97 |
98 |
0.06 |
2.94 |
0.17 |
|
PFDoA |
2.00 |
2.08 |
1.91 |
2.02 |
2.05 |
2.02 |
2.03 |
2.04 |
2.04 |
2.02 |
101 |
0.05 |
2.52 |
0.15 |
*Analytes were used in salt form and calculated concentrations were corrected to compensate where needed.
|
TurboVap® LV |
Laboratory Reagent Blanks |
|||||||||||
|
Replicate |
1 |
2 |
3 |
4 |
5 |
6 |
7 |
8 |
1 |
2 |
3 |
4 |
|
PFBA* |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.10 |
0.05 |
0.04 |
0.09 |
0.06 |
0.06 |
0.06 |
|
PFPeA |
0.02 |
0.03 |
0.03 |
0.03 |
0.03 |
0.06 |
0.02 |
0.03 |
0.04 |
0.04 |
0.02 |
0.04 |
|
PFBS |
0.01 |
0.00 |
0.00 |
0.00 |
0.01 |
0.00 |
0.01 |
0.01 |
0.00 |
0.00 |
0.00 |
0.06 |
|
PFHxA |
0.01 |
0.02 |
0.00 |
0.01 |
0.00 |
0.02 |
0.01 |
0.02 |
0.02 |
0.02 |
0.02 |
0.02 |
|
PFHpA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFHxS* |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.01 |
0.00 |
0.01 |
0.01 |
0.01 |
|
PFHpS* |
0.00 |
0.02 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
H4PFOS* |
0.02 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.01 |
0.05 |
0.06 |
0.07 |
0.07 |
|
PFOA |
0.02 |
0.00 |
0.00 |
0.00 |
0.03 |
0.00 |
0.01 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFOS* |
0.00 |
0.00 |
0.00 |
0.00 |
0.03 |
0.00 |
0.00 |
0.02 |
0.01 |
0.02 |
0.01 |
0.01 |
|
PFNA |
0.00 |
0.00 |
0.00 |
0.01 |
0.00 |
0.00 |
0.00 |
0.00 |
0.02 |
0.00 |
0.01 |
0.00 |
|
PFDA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.02 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFDS |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFUnA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFDoA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
*Analytes were used in salt form and calculated concentrations were corrected to compensate where needed.
|
TurboVap® LV |
Laboratory Reagent Blanks |
|||||||
|
Replicate |
1 |
2 |
3 |
4 |
1 |
2 |
3 |
4 |
|
PFBA* |
0.06 |
0.02 |
0.01 |
0.00 |
0.11 |
0.09 |
0.09 |
0.10 |
|
PFPeA |
0.03 |
0.03 |
0.03 |
0.02 |
0.05 |
0.06 |
0.04 |
0.04 |
|
PFBS |
0.01 |
0.01 |
0.00 |
0.00 |
0.00 |
0.01 |
0.01 |
0.01 |
|
PFHxA |
0.02 |
0.02 |
0.01 |
0.00 |
0.03 |
0.03 |
0.02 |
0.02 |
|
PFHpA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFHxS* |
0.01 |
0.01 |
0.00 |
0.00 |
0.01 |
0.01 |
0.01 |
0.01 |
|
PFHpS* |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
H4PFOS* |
0.01 |
0.00 |
0.00 |
0.00 |
0.03 |
0.03 |
0.04 |
0.02 |
|
PFOA |
0.00 |
0.02 |
0.03 |
0.00 |
0.00 |
0.00 |
0.05 |
0.00 |
|
PFOS* |
0.00 |
0.00 |
0.01 |
0.01 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFNA |
0.00 |
0.01 |
0.00 |
0.00 |
0.00 |
0.00 |
0.01 |
0.00 |
|
PFDA |
0.00 |
0.02 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.02 |
|
PFDS |
0.00 |
0.00 |
0.01 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFUnA |
0.00 |
0.00 |
0.00 |
0.00 |
0.02 |
0.00 |
0.00 |
0.00 |
|
PFDoA |
0.00 |
0.06 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
*Analytes were used in salt form and calculated concentrations were corrected to compensate where needed.
|
Replicate |
1 (%) |
2 (%) |
3 (%) |
4 (%) |
x̅ (%) |
s (%) |
CV (%) |
|
PFBA* |
93.97 |
93.52 |
97.66 |
94.56 |
94.93 |
1.87 |
1.97 |
|
PFPeA |
91.10 |
99.84 |
99.34 |
92.16 |
95.61 |
4.62 |
4.83 |
|
PFBS |
88.73 |
88.20 |
91.76 |
86.48 |
88.79 |
2.20 |
2.47 |
|
PFHxA |
94.83 |
95.12 |
99.13 |
95.85 |
96.23 |
1.98 |
2.06 |
|
PFHpA |
104.38 |
106.43 |
104.54 |
106.18 |
105.38 |
1.07 |
1.02 |
|
PFHxS* |
95.20 |
99.75 |
101.57 |
95.96 |
98.12 |
3.04 |
3.10 |
|
PFHpS* |
89.31 |
87.18 |
98.22 |
79.57 |
88.57 |
7.67 |
8.66 |
|
H4PFOS* |
96.43 |
102.56 |
100.83 |
101.53 |
100.34 |
2.70 |
2.69 |
|
PFOA |
94.28 |
94.77 |
96.59 |
92.79 |
94.61 |
1.56 |
1.65 |
|
PFOS* |
91.58 |
93.17 |
98.48 |
89.66 |
93.22 |
3.79 |
4.06 |
|
PFNA |
93.76 |
98.27 |
100.96 |
96.89 |
97.47 |
2.99 |
3.07 |
|
PFDA |
96.19 |
91.59 |
101.20 |
100.51 |
97.38 |
4.45 |
4.57 |
|
PFDS |
96.50 |
102.88 |
108.47 |
98.56 |
101.60 |
5.29 |
5.21 |
|
PFUnA |
88.89 |
85.05 |
87.96 |
90.74 |
88.16 |
2.37 |
2.69 |
|
PFDoA |
96.65 |
99.00 |
102.74 |
98.79 |
99.30 |
2.53 |
2.55 |
|
*Analytes were used in salt form and calculated concentrations were corrected to compensate where needed. |
|
|
|||||
|
Replicate |
1 (%) |
2 (%) |
3 (%) |
4 (%) |
x̅ (%) |
s (%) |
CV (%) |
|
PFBA* |
102.37 |
101.69 |
101.80 |
103.26 |
102.28 |
0.72 |
0.70 |
|
PFPeA |
101.89 |
102.16 |
101.32 |
100.30 |
101.42 |
0.82 |
0.81 |
|
PFBS |
99.30 |
102.15 |
99.56 |
102.63 |
100.91 |
1.72 |
1.71 |
|
PFHxA |
100.58 |
103.25 |
99.56 |
100.27 |
100.92 |
1.61 |
1.60 |
|
PFHpA |
102.78 |
102.88 |
102.64 |
102.10 |
102.60 |
0.35 |
0.34 |
|
PFHxS* |
97.07 |
98.52 |
98.87 |
97.40 |
97.96 |
0.86 |
0.88 |
|
PFHpS* |
91.57 |
92.08 |
90.92 |
93.18 |
91.94 |
0.95 |
1.04 |
|
H4PFOS* |
99.40 |
99.12 |
104.89 |
102.46 |
101.47 |
2.74 |
2.70 |
|
PFOA |
104.83 |
105.70 |
104.59 |
106.65 |
105.44 |
0.94 |
0.89 |
|
PFOS* |
101.18 |
103.31 |
101.24 |
102.55 |
102.07 |
1.04 |
1.02 |
|
PFNA |
102.52 |
103.28 |
101.34 |
101.57 |
102.18 |
0.90 |
0.88 |
|
PFDA |
102.85 |
104.63 |
101.29 |
103.65 |
103.10 |
1.41 |
1.37 |
|
PFDS |
105.46 |
102.18 |
103.54 |
106.38 |
104.39 |
1.89 |
1.81 |
|
PFUnA |
98.55 |
97.67 |
97.27 |
98.90 |
98.10 |
0.76 |
0.77 |
|
PFDoA |
105.74 |
103.29 |
103.54 |
105.36 |
104.48 |
1.25 |
1.19 |
|
Replicate |
1 (ng/L) |
2 (ng/L) |
3 (ng/L) |
4 (ng/L) |
x̅ (ng/L) |
|
PFBA* |
0.11 |
0.09 |
0.09 |
0.09 |
0.09 |
|
PFPeA |
0.04 |
0.04 |
0.04 |
0.04 |
0.04 |
|
PFBS |
0.02 |
0.01 |
0.02 |
0.01 |
0.02 |
|
PFHxA |
0.02 |
0.02 |
0.03 |
0.03 |
0.03 |
|
PFHpA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFHxS* |
0.02 |
0.00 |
0.02 |
0.01 |
0.01 |
|
PFHpS* |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
H4PFOS* |
0.04 |
0.04 |
0.04 |
0.04 |
0.04 |
|
PFOA |
0.09 |
0.04 |
0.07 |
0.00 |
0.05 |
|
PFOS* |
0.04 |
0.03 |
0.04 |
0.04 |
0.04 |
|
PFNA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFDA |
0.02 |
0.02 |
0.02 |
0.02 |
0.02 |
|
PFDS |
0.03 |
0.00 |
0.00 |
0.00 |
0.01 |
|
PFUnA |
0.00 |
0.00 |
0.03 |
0.01 |
0.01 |
|
PFDoA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
Literature number: AN968