Per- and polyfluorinated alkyl substances (PFAS) have been used abundantly since their inception in the twentieth century and have become a closely monitored class of compounds within environmental testing. This application note outlines a procedure for those seeking to follow EPA Method 533. The data presented was generated using a Biotage® VacMaster™ vacuum manifold with a PFAS free Large Volume Extraction (LVE) kit in conjunction with EVOLUTE® PFAS 533 SPE cartridges and a TurboVap® LV system.
|
Analyte Name |
Acronym |
CAS |
|
Target Analytes |
|
|
|
11-Chloroeicosafluoro-3-oxaundecane-1-sulfonic acid |
11Cl-PF3OUdS |
763051-92-9 |
|
9-Chlorohexadecafluoro-3-oxanonane-1-sulfonic acid |
9Cl-PF3ONS |
756426-58-1 |
|
4,8-Dioxa-3H-perfluorononanoic acid |
ADONA |
919005-14-4 |
|
Hexafluoropropylene oxide dimer acid |
HFPO-DA |
13252-13-6 |
|
Nonafluoro-3,6-dioxaheptanoic acid |
NFDHA |
151772-58-6 |
|
Perfluorobutanoic acid |
PFBA |
375-22-4 |
|
Perfluorobutanesulfonic acid |
PFBS |
375-73-5 |
|
1H,1H,2H,2H-Perfluorodecane sulfonic acid |
8:2FTS |
39108-34-4 |
|
Perfluorodecanoic acid |
PFDA |
335-76-2 |
|
Perfluorododecanoic acid |
PFDoA |
307-55-1 |
|
Perfluoro(2-ethoxyethane)sulfonic acid |
PFEESA |
113507-82-7 |
|
Perfluoroheptanesulfonic acid |
PFHpS |
375-92-8 |
|
Perfluoroheptanoic acid |
PFHpA |
375-85-9 |
|
1H,1H,2H,2H-Perfluorohexane sulfonic acid |
4:2FTS |
757124-72-4 |
|
Perfluorohexanesulfonic acid |
PFHxS |
355-46-4 |
|
Perfluorohexanoic acid |
PFHxA |
307-24-4 |
|
Perfluoro-3-methoxypropanoic acid |
PFMPA |
377-73-1 |
|
Perfluoro-4-methoxybutanoic acid |
PFMBA |
863090-89-5 |
|
Perfluorononanoic acid |
PFNA |
375-95-1 |
|
1H,1H,2H,2H-Perfluorooctane sulfonic acid |
6:2FTS |
27619-97-2 |
|
Perfluorooctanesulfonic acid |
PFOS |
1763-23-1 |
|
Perfluorooctanoic acid |
PFOA |
335-67-1 |
|
Perfluoropentanoic acid |
PFPeA |
2706-90-3 |
|
Perfluoropentanesulfonic acid |
PFPeS |
2706-91-4 |
|
Perfluoroundecanoic acid |
PFUnA |
2058-94-8 |
|
Isotope Performance Standards |
|
|
|
Perfluoro-n-[2,3,4-13C3]butanoic acid |
13C3-PFBA |
|
|
Perfluoro-[1,2-13C2]octanoic acid |
13C2-PFOA |
|
|
Sodium perfluoro-1-[1,2,3,4-13C4]octanesulfonate |
13C4-PFOS |
|
|
Isotope Dilution Standards |
|
|
|
Perfluoro-n-[1,2,3,4-13C4]butanoic acid |
13C4-PFBA |
|
|
Perfluoro-n-[1,2,3,4,5-13C5]pentanoic acid |
13C5-PFPeA |
|
|
Sodium perfluoro-1-[2,3,4-13C3]butanesulfonate |
13C3-PFBS |
|
|
Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]hexane sulfonate |
13C2-4:2FTS |
|
|
Perfluoro-n-[1,2,3,4,6-13C5]hexanoic acid |
13C5-PFHxA |
|
|
2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy-13C3-propanoic acid |
13C3-HFPO-DA |
|
|
Perfluoro-n-[1,2,3,4-13C4]heptanoic acid |
13C4-PFHpA |
|
|
Sodium perfluoro-1-[1,2,3-13C3]hexanesulfonate |
13C3-PFHxS |
|
|
Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]-octane sulfonate |
13C2-6:2FTS |
|
|
Perfluoro-n-[13C8]octanoic acid |
13C8-PFOA |
|
|
Perfluoro-n-[13C9]nonanoic acid |
13C9-PFNA |
|
|
Sodium perfluoro-[13C8]octanesulfonate |
13C8-PFOS |
|
|
Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]-decane sulfonate |
13C2-8:2FTS |
|
|
Perfluoro-n-[1,2,3,4,5,6-13C6]decanoic acid |
13C6-PFDA |
|
|
Perfluoro-n-[1,2,3,4,5,6,7-13C7]undecanoic acid |
13C7-PFUnA |
|
|
Perfluoro-n-[1,2-13C2]dodecanoic acid |
13C2-PFDoA |
|
1. Add 2 mL of NH4OH for every 98 mL of methanol to a clean beaker.
2. Agitate to homogenize the solution.
3. Prepare fresh prior to each day of extraction.
1. Add 4.45 g of monobasic sodium phosphate and 2.5 g of dibasic sodium phosphate for every 500 mL of reagent water to a clean beaker.
2. Sonicate the solution for 5 minutes to dissolve the salt.
1. Add 1 g of NH4OAc for every 1 L of reagent water to a clean beaker.
2. Sonicate the solution for 5 minutes to dissolve the salt.
1. Dilute 100 μL of the native stock solution with 900 μL of methanol to achieve a 50 ppt solution.
EVOLUTE® PFAS 500 mg/6 mL or EVOLUTE® PFAS 533 200 mg/6 mL
If needed, adjust the pH of each sample to be between 6.0 and
8.0 using acetic acid. Add target analytes and isotope dilution standards as needed.
Condition each cartridge with methanol (10 mL) followed by 0.1 M phosphate buffer (10 mL).
Equilibrate each cartridge with phosphate buffer (3 mL) followed immediately by reagent water (3 mL).
Load sample at a flow rate of 5 mL/min.
Rinse the sample container with acetate buffer solution (10 mL) and load onto the cartridge. Repeat using methanol (1 mL).
Dry the cartridge for 5 minutes at a flow rate of 25 mL/min.
Rinse the sample container with 2% NH4OH in methanol (5 mL) and use to elute the analytes from the cartridge at a flow rate of 2 mL/min. Repeat this rinse one additional time.
Concentrate the extract to dryness and reconstitute using 990 μL of 80:20 methanol: reagent water. Add isotope performance standards and mix prior to analysis.
Bath Temp: 60 ˚C
Evaporation Mode: Method (Ramp Gradient)
Manifold Setup: 48 positions
Rack Row Height: 120 mm*
Step 1: 1.5 L/min for 20 min
Step 2: 3.0 L/min for 15 min
Step 3: 3.5 L/min for 45 min
*The nozzle position was adjusted such that it was as far to the right as possible to give the user a clear view of the vortex within the tube.
» 1290 Infinity II Multicartridge Thermostat, G7116B
» 1290 Infinity II Multisampler, G7167B
» 1290 Infinity II High Speed Pump, G7120A
» InfinityLab PFC-free HPLC Conversion Kit, 5004-0006
» InfinityLab PFC Delay Column, 4.6 x 30 mm, p/n 5062-8100
» ZORBAX RRHD Eclipse Plus C18, 95 Å, 22.1 x 50 mm, 1.8 µm, p/n 959757-902
» A: 20 mM Ammonium Acetate in Water
» B: Methanol
|
Time (min) |
%A |
%B |
|
0.50 |
95.00 |
5.00 |
|
3.00 |
60.00 |
40.00 |
|
16.00 |
20.00 |
80.00 |
|
18.00 |
20.00 |
80.00 |
|
20.00 |
5.00 |
95.00 |
» Flow Rate: 0.2 mL/min
» Injection Volume: 5 μL
» Cartridge Temperature: 50 ˚C
» Gas Temperature: 230 ˚C
» Gas Flow: 4 L/min
» Nebulizer: 20 psi
» Sheath Gas Temperature: 375 ˚C
» Sheath Gas Flow: 12 L/min
» Capillary Voltage (Positive): 3500 V
» Capillary Voltage (Negative): 3500 V
» Nozzle Voltage (Positive): 500 V
» Nozzle Voltage (Negative): 0 V
For a complete listing of MRM Transitions, see Appendix B
For the work being done here, a total of six points were used in the calibration covering a range of 0.2-100 ppt in the sample. The lowest three points were below the calculated MRL. The curve was forced through zero and used a 1/x weighting.
PFBS
PFMPA
Figure 1. Calibration curves for PFBS and PFMPA. Calibration curves for the remaining target analytes in Table 1 are shown in Appendix C.
A target MRL of 2 ng/L was selected and at least seven replicate laboratory fortified blanks (LFBs) were created and run at that concentration. The resulting data were then used to calculate the half-range for the prediction interval (HRPIR), the upper and lower bounds for the PIR, and the DL. Figures 2 and 3 illustrate the results of this test for both the 200 mg and 500 mg cartridges respectively using 250 mL sample volumes.
Figure 2. Upper and Lower calculated PIR limits with the range of acceptance shown in white for EVOLUTE® PFAS 533 200 mg cartridges. Those compounds with an asterisk were used in salt form.
Based on the data obtained, the calculated upper and lower PIR were all well within the specified boundaries and the calculated MRL concentrations are all deemed acceptable.
The data for individual compounds are contained within Appendix D.
An investigation into the background of the complete process was done in two steps. The first step was to load centrifuge tubes containing a similar volume of methanol as would result from the extraction process onto the evaporation system, allowing them to concentrate and then run on the analytical system (evaporation blank). The second step was to create a full Laboratory Reagent Blank (LRB), extract and concentrate it, and run it on the analytical system. By separating the process into these steps it becomes easier to determine what, if any, contribution to the overall background each of the steps has. The result of these tests are given in Appendix E and selected data are shown below in Figures 4–6.
Figure 4. Contribution of the TurboVap® LV to the PFAS Background. Those compounds with an asterisk were used in salt form.
Figure 5. PFAS Background for full LRB using EVOLUTE® PFAS 533 200 mg/6 mL cartridges. Those compounds with an asterisk were used in salt form.
Figure 6. PFAS Background for full LRB using EVOLUTE® PFAS 533 500 mg/6 mL cartridges. Those compounds with an asterisk were used in salt form.
When examining the data resulting for both the TurboVap® LV and the full LRB tests (which includes the Biotage® VacMaster™ manifold, PFAS Free Large Volume Loading Kit, and the EVOLUTE® cartridges as well as the TurboVap® LV) there are clear indications of the presence of a PFAS background. However, even at the highest concentrations detected, all levels are more than 8 times lower than the 1/3 MRL limit indicating that the background is acceptable and will not interfere with future sample runs.
To determine the precision and accuracy of the sample preparation process, four LFB samples were prepared at concentrations of 20 ppt. The data is given in Appendix F and illustrated in Figures 7 and 8.
Figure 7. Initial Demonstration of Accuracy (20 ng/L, n=4). Those compounds with an asterisk were used in salt form.
Figure 8. Initial Demonstration of Precision (20 ng/L, n=4). Those compounds with an asterisk were used in salt form.
The results show that the average recovery for each target analyte was within 30% of the nominal value and that the coefficient of variation (CV) for each analyte fell under 10% on average.
To simulate an influent sample, four LFB samples were created with concentrations which were above the range of the calibration curve. These samples were extracted, and the clean up procedure given in Appendix A was run three times. To ensure that the system background was adequately reduced, a set of four LRB samples were extracted immediately afterwards and analysed. The LRB data is presented in Appendix G and illustrated in Figure 9.
Figure 9. Results of carryover study following four, 200 ng/L LFB samples using EVOLUTE® PFAS 533 500 mg/6 mL cartridges. Those compounds with an asterisk were used in salt form.
The graph shown in Figure 9 shows a clear indication that the cleaning procedure in Appendix A was successful in reducing the background of PFAS compounds to below the 1/3 MRL limit. For further reductions in the background, additional cleaning steps could be employed.
With the scrutiny being given to the presence of PFAS compounds in the environment, it is essential to find reliable products which can meet the requirements of EPA Method 533. This application note has shown that the Biotage® VacMaster™ vacuum manifold with PFAS free accessories, EVOLUTE® PFAS 533 SPE cartridges and the TurboVap® LV can be used to easily meet and exceed the demands of the method.
|
Part Number |
Description |
Qty |
|---|---|---|
|
121-2016 |
Biotage® VacMaster™-20 Sample Processing Station (with 16 mm rack) |
1 |
|
121-2190 |
Biotage® VacMaster™ LVE Kit (PFAS) for 1, 3, 6 mL SPE Cartridges |
1 |
|
121-2195 |
Biotage® VacMaster™ Trap Kit, 10 L |
1 |
|
121-0009-PP |
Polypropylene (PFAS) Stopcocks |
10 |
|
604-0050-C-533 |
EVOLUTE® PFAS 533 500 mg/6 mL cartridges |
30 |
|
604-0020-C-533 |
EVOLUTE® PFAS 533 200 mg/6 mL cartridges |
30 |
|
415000 |
TurboVap® LV Automated Solvent Evaporation System |
1 |
|
414964 |
TurboVap® LV Multi Rack (48 Positions, 10–20 mm Tubes) |
1 |
For the best results, it is recommended that this procedure be completed before the use of the VacMaster™ each day and at the end of each extraction prior to proceeding with the next set of samples.
Note: In situations where the previous sample was highly concentrated, the above cleaning procedure may need to be repeated multiple times. If there is concern regarding potential carryover contamination regardless of the cleaning procedure, a laboratory reagent blank should be run in that position to ensure its cleanliness.
|
Cpd Name |
ISTD? |
Prec Ion |
MS1 Res |
Prod Ion |
MS2 Res |
Frag (V) |
CE (V) |
Cell Acc (V) |
Ret Time (min) |
Ret Window |
Polarity |
|
11Cl-PF3OUdS |
No |
630.9 |
Unit/Enh (6490) |
450.9 |
Unit/Enh (6490) |
165 |
32 |
5 |
17.6 |
1.76 |
Negative |
|
11Cl-PF3OUdS |
No |
630.9 |
Unit/Enh (6490) |
82.9 |
Unit/Enh (6490) |
165 |
32 |
5 |
17.6 |
1.76 |
Negative |
|
4:2FTS |
No |
327 |
Unit/Enh (6490) |
306.9 |
Unit/Enh (6490) |
125 |
20 |
5 |
9.2 |
1.55 |
Negative |
|
4:2FTS |
No |
327 |
Unit/Enh (6490) |
80.9 |
Unit/Enh (6490) |
125 |
36 |
5 |
9.2 |
1.55 |
Negative |
|
6:2FTS |
No |
427 |
Unit/Enh (6490) |
406.8 |
Unit/Enh (6490) |
125 |
24 |
5 |
13.09 |
1.31 |
Negative |
|
6:2FTS |
No |
427 |
Unit/Enh (6490) |
80.9 |
Unit/Enh (6490) |
125 |
40 |
5 |
13.09 |
1.31 |
Negative |
|
8:2FTS |
No |
527 |
Unit/Enh (6490) |
506.8 |
Unit/Enh (6490) |
170 |
28 |
5 |
16.14 |
1.61 |
Negative |
|
8:2FTS |
No |
527 |
Unit/Enh (6490) |
80.9 |
Unit/Enh (6490) |
170 |
40 |
5 |
16.14 |
1.61 |
Negative |
|
9Cl-PF3ONS |
No |
530.9 |
Unit/Enh (6490) |
350.9 |
Unit/Enh (6490) |
145 |
28 |
5 |
15.49 |
1.55 |
Negative |
|
9Cl-PF3ONS |
No |
530.9 |
Unit/Enh (6490) |
83 |
Unit/Enh (6490) |
145 |
32 |
5 |
15.49 |
1.55 |
Negative |
|
ADONA |
No |
377 |
Unit/Enh (6490) |
250.9 |
Unit/Enh (6490) |
80 |
12 |
5 |
11.74 |
1.39 |
Negative |
|
ADONA |
No |
377 |
Unit/Enh (6490) |
85 |
Unit/Enh (6490) |
80 |
36 |
5 |
11.74 |
1.39 |
Negative |
|
C2-4:2FTS |
No |
329 |
Unit/Enh (6490) |
309 |
Unit/Enh (6490) |
125 |
20 |
5 |
9.2 |
1.55 |
Negative |
|
C2-6:2FTS |
No |
429 |
Unit/Enh (6490) |
409 |
Unit/Enh (6490) |
125 |
24 |
5 |
13.28 |
1.47 |
Negative |
|
C2-8:2FTS |
No |
529 |
Unit/Enh (6490) |
509 |
Unit/Enh (6490) |
170 |
28 |
5 |
15.93 |
1.59 |
Negative |
|
C2-PFDoA |
No |
614.9 |
Unit/Enh (6490) |
570 |
Unit/Enh (6490) |
79 |
5 |
5 |
18.02 |
1.8 |
Negative |
|
C2-PFOA |
No |
415 |
Unit/Enh (6490) |
369.9 |
Unit/Enh (6490) |
80 |
8 |
5 |
13.19 |
1.55 |
Negative |
|
C2-PFOA |
No |
415 |
Unit/Enh (6490) |
168.9 |
Unit/Enh (6490) |
80 |
20 |
5 |
13.19 |
1.55 |
Negative |
|
C3-HFPO-DA |
No |
287 |
Unit/Enh (6490) |
184.9 |
Unit/Enh (6490) |
160 |
20 |
5 |
10.06 |
1.07 |
Negative |
|
C3-HFPO-DA |
No |
287 |
Unit/Enh (6490) |
168.9 |
Unit/Enh (6490) |
160 |
4 |
5 |
10.06 |
1.07 |
Negative |
|
C3-PFBA |
No |
216 |
Unit/Enh (6490) |
171.9 |
Unit/Enh (6490) |
65 |
8 |
5 |
5.05 |
2.05 |
Negative |
|
C3-PFBS |
No |
302 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
45 |
5 |
7.68 |
1.56 |
Negative |
|
C3-PFHxS |
No |
402 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
45 |
5 |
11.6 |
1.54 |
Negative |
|
C4-PFBA |
No |
217 |
Unit/Enh (6490) |
172 |
Unit/Enh (6490) |
60 |
8 |
5 |
5.05 |
2.2 |
Negative |
|
C4-PFHpA |
No |
367 |
Unit/Enh (6490) |
322 |
Unit/Enh (6490) |
72 |
0 |
5 |
11.43 |
1.6 |
Negative |
|
C4-PFOS |
No |
502.9 |
Unit/Enh (6490) |
98.9 |
Unit/Enh (6490) |
180 |
48 |
5 |
14.71 |
1.53 |
Negative |
|
C4-PFOS |
No |
502.9 |
Unit/Enh (6490) |
79.9 |
Unit/Enh (6490) |
180 |
52 |
5 |
14.71 |
1.53 |
Negative |
|
C5-PFHxA |
No |
318 |
Unit/Enh (6490) |
273 |
Unit/Enh (6490) |
70 |
8 |
5 |
9.39 |
1.59 |
Negative |
|
C5-PFPeA |
No |
268 |
Unit/Enh (6490) |
223 |
Unit/Enh (6490) |
60 |
8 |
5 |
7.21 |
1.58 |
Negative |
|
C6-PFDA |
No |
519 |
Unit/Enh (6490) |
474 |
Unit/Enh (6490) |
81 |
4 |
5 |
15.97 |
1.6 |
Negative |
|
C7-PFUnA |
No |
570 |
Unit/Enh (6490) |
525 |
Unit/Enh (6490) |
73 |
5 |
5 |
17.07 |
1.71 |
Negative |
|
Cpd Name |
ISTD? |
Prec Ion |
MS1 Res |
Prod Ion |
MS2 Res |
Frag (V) |
CE (V) |
Cell Acc (V) |
Ret Time (min) |
Ret Window |
Polarity |
|
C8-PFOA |
No |
421 |
Unit/Enh (6490) |
376 |
Unit/Enh (6490) |
69 |
4 |
5 |
13.19 |
1.55 |
Negative |
|
C8-PFOS |
No |
507 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
50 |
5 |
14.71 |
1.52 |
Negative |
|
C9-PFNA |
No |
472 |
Unit/Enh (6490) |
427 |
Unit/Enh (6490) |
66 |
4 |
5 |
14.68 |
1.53 |
Negative |
|
HFPO-DA-CO2 |
No |
285 |
Unit/Enh (6490) |
184.9 |
Unit/Enh (6490) |
155 |
16 |
5 |
10.06 |
1.01 |
Negative |
|
HFPO-DA-CO2 |
No |
285 |
Unit/Enh (6490) |
168.9 |
Unit/Enh (6490) |
155 |
4 |
5 |
10.06 |
1.01 |
Negative |
|
NFDHA |
No |
295 |
Unit/Enh (6490) |
201 |
Unit/Enh (6490) |
75 |
5 |
5 |
9.06 |
1.02 |
Negative |
|
NFDHA-CO2 |
No |
251 |
Unit/Enh (6490) |
84.9 |
Unit/Enh (6490) |
130 |
20 |
5 |
11.74 |
1.42 |
Negative |
|
PFBA |
No |
213 |
Unit/Enh (6490) |
168.9 |
Unit/Enh (6490) |
60 |
8 |
5 |
5.05 |
2.05 |
Negative |
|
PFBS |
No |
298.9 |
Unit/Enh (6490) |
98.9 |
Unit/Enh (6490) |
100 |
29 |
5 |
7.68 |
1.43 |
Negative |
|
PFBS |
No |
298.9 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
45 |
5 |
7.68 |
1.43 |
Negative |
|
PFDA |
No |
513 |
Unit/Enh (6490) |
469 |
Unit/Enh (6490) |
81 |
4 |
5 |
15.97 |
1.6 |
Negative |
|
PFDA |
No |
513 |
Unit/Enh (6490) |
218.7 |
Unit/Enh (6490) |
100 |
16 |
5 |
15.97 |
1.6 |
Negative |
|
PFDoA |
No |
613 |
Unit/Enh (6490) |
569 |
Unit/Enh (6490) |
79 |
5 |
5 |
18.02 |
1.8 |
Negative |
|
PFDoA |
No |
613 |
Unit/Enh (6490) |
268.7 |
Unit/Enh (6490) |
100 |
20 |
5 |
18.02 |
1.8 |
Negative |
|
PFEESA |
No |
314.9 |
Unit/Enh (6490) |
134.9 |
Unit/Enh (6490) |
110 |
24 |
5 |
8.57 |
1.55 |
Negative |
|
PFEESA |
No |
314.9 |
Unit/Enh (6490) |
69 |
Unit/Enh (6490) |
110 |
60 |
5 |
8.57 |
1.55 |
Negative |
|
PFHpA |
No |
362.9 |
Unit/Enh (6490) |
319 |
Unit/Enh (6490) |
72 |
0 |
5 |
11.43 |
1.57 |
Negative |
|
PFHpA |
No |
362.9 |
Unit/Enh (6490) |
169 |
Unit/Enh (6490) |
72 |
12 |
5 |
11.43 |
1.57 |
Negative |
|
PFHpS |
No |
448.9 |
Unit/Enh (6490) |
98.7 |
Unit/Enh (6490) |
100 |
44 |
5 |
13.48 |
1.35 |
Negative |
|
PFHpS |
No |
448.9 |
Unit/Enh (6490) |
79.7 |
Unit/Enh (6490) |
100 |
52 |
5 |
13.48 |
1.35 |
Negative |
|
PFHxA |
No |
313 |
Unit/Enh (6490) |
268.9 |
Unit/Enh (6490) |
70 |
8 |
5 |
9.39 |
1.54 |
Negative |
|
PFHxA |
No |
313 |
Unit/Enh (6490) |
119 |
Unit/Enh (6490) |
70 |
18 |
5 |
9.39 |
1.54 |
Negative |
|
PFHxS |
No |
398.9 |
Unit/Enh (6490) |
99 |
Unit/Enh (6490) |
100 |
45 |
5 |
11.5 |
2.1 |
Negative |
|
PFHxS |
No |
398.9 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
49 |
5 |
11.5 |
2.1 |
Negative |
|
PFMBA |
No |
279 |
Unit/Enh (6490) |
84.9 |
Unit/Enh (6490) |
70 |
12 |
5 |
7.9 |
1.58 |
Negative |
|
PFMPA |
No |
229 |
Unit/Enh (6490) |
84.9 |
Unit/Enh (6490) |
60 |
12 |
5 |
5.95 |
1.58 |
Negative |
|
PFNA |
No |
463 |
Unit/Enh (6490) |
419 |
Unit/Enh (6490) |
66 |
4 |
5 |
14.69 |
1.47 |
Negative |
|
PFNA |
No |
463 |
Unit/Enh (6490) |
219 |
Unit/Enh (6490) |
66 |
17 |
5 |
14.69 |
1.47 |
Negative |
|
PFOA |
No |
413 |
Unit/Enh (6490) |
369 |
Unit/Enh (6490) |
69 |
4 |
5 |
13.19 |
1.55 |
Negative |
|
PFOA |
No |
413 |
Unit/Enh (6490) |
169 |
Unit/Enh (6490) |
69 |
12 |
5 |
13.19 |
1.55 |
Negative |
|
PFOS |
No |
498.9 |
Unit/Enh (6490) |
99 |
Unit/Enh (6490) |
100 |
50 |
5 |
14.6 |
2 |
Negative |
|
PFOS |
No |
498.9 |
Unit/Enh (6490) |
80 |
Unit/Enh (6490) |
100 |
50 |
5 |
14.6 |
2 |
Negative |
|
PFPeA |
No |
263 |
Unit/Enh (6490) |
218.9 |
Unit/Enh (6490) |
60 |
8 |
5 |
7.21 |
1.57 |
Negative |
|
PFPeS |
No |
348.9 |
Unit/Enh (6490) |
98.9 |
Unit/Enh (6490) |
135 |
40 |
5 |
9.7 |
1.54 |
Negative |
|
PFPeS |
No |
348.9 |
Unit/Enh (6490) |
79.9 |
Unit/Enh (6490) |
135 |
40 |
5 |
9.7 |
1.54 |
Negative |
|
PFUnA |
No |
563 |
Unit/Enh (6490) |
519 |
Unit/Enh (6490) |
73 |
5 |
5 |
17.07 |
1.71 |
Negative |
|
PFUnA |
No |
563 |
Unit/Enh (6490) |
269 |
Unit/Enh (6490) |
100 |
20 |
5 |
17.07 |
1.71 |
Negative |
Figure 10. Calibration curves for the target analytes in Table 1, covering a concentration range of 0.2-100 ppt.
|
|
Conc. |
1 |
2 |
3 |
4 |
5 |
6 |
7 |
Average Std Dev |
HRPIR |
Lower |
Upper |
DL |
|
|
(ng/L) |
(ng/L) |
(ng/L) |
(ng/L) |
(ng/L) |
(ng/L) |
(ng/L) |
(ng/L) |
(ng/L) (ng/L) (ng/L) |
PIR |
PIR |
(ng/L) |
|||
|
|
|
|
|
|
|
|
|
|
|
|
% |
% |
|
|
|
PFBA |
2.00 |
2.27 |
2.30 |
2.27 |
2.16 |
2.17 |
2.19 |
2.24 |
2.23 |
0.05 |
0.22 |
100.5 |
122.3 |
0.17 |
|
PFMPA |
2.00 |
2.14 |
2.26 |
2.13 |
2.06 |
2.04 |
2.11 |
2.12 |
2.12 |
0.07 |
0.28 |
92.1 |
120.2 |
0.22 |
|
PFPeA |
2.00 |
2.16 |
2.16 |
2.10 |
2.03 |
1.98 |
2.04 |
2.16 |
2.09 |
0.08 |
0.30 |
89.6 |
119.4 |
0.24 |
|
PFBS* |
1.77 |
1.94 |
1.96 |
1.84 |
1.81 |
1.78 |
1.80 |
1.91 |
1.87 |
0.07 |
0.28 |
79.2 |
107.4 |
0.22 |
|
PFMBA |
2.00 |
2.28 |
2.23 |
2.30 |
2.19 |
2.08 |
2.31 |
2.27 |
2.24 |
0.08 |
0.32 |
96.0 |
127.8 |
0.25 |
|
PFEESA* |
1.78 |
1.90 |
1.93 |
1.92 |
1.83 |
1.78 |
1.85 |
1.92 |
1.88 |
0.06 |
0.23 |
82.2 |
105.3 |
0.18 |
|
NFDHA |
2.00 |
2.06 |
2.12 |
2.26 |
1.96 |
1.98 |
1.95 |
1.92 |
2.03 |
0.12 |
0.48 |
77.8 |
125.7 |
0.38 |
|
4:2 FTS* |
1.88 |
2.09 |
2.03 |
2.05 |
1.99 |
1.95 |
2.00 |
1.88 |
2.00 |
0.07 |
0.27 |
86.6 |
113.3 |
0.21 |
|
PFHxA |
2.00 |
2.21 |
2.21 |
2.24 |
2.06 |
2.23 |
2.20 |
2.20 |
2.19 |
0.06 |
0.24 |
97.7 |
121.5 |
0.19 |
|
PFPeS* |
1.88 |
2.04 |
2.03 |
2.06 |
1.90 |
1.82 |
1.89 |
2.04 |
1.97 |
0.10 |
0.38 |
79.3 |
117.4 |
0.30 |
|
HFPO-DA |
2.00 |
2.23 |
2.25 |
2.19 |
2.13 |
1.94 |
2.08 |
2.15 |
2.14 |
0.11 |
0.42 |
85.9 |
128.0 |
0.33 |
|
PFHpA |
2.00 |
2.04 |
2.05 |
2.02 |
2.03 |
1.99 |
2.03 |
2.13 |
2.04 |
0.04 |
0.17 |
93.3 |
110.7 |
0.14 |
|
PFHxS* |
1.83 |
1.92 |
2.00 |
1.99 |
1.89 |
1.85 |
1.82 |
1.94 |
1.91 |
0.07 |
0.27 |
82.2 |
109.2 |
0.21 |
|
ADONA* |
1.89 |
1.71 |
1.68 |
1.70 |
1.71 |
1.63 |
1.71 |
1.79 |
1.70 |
0.05 |
0.19 |
75.8 |
94.7 |
0.15 |
|
6:2 FTS* |
1.90 |
1.91 |
2.11 |
2.08 |
1.99 |
1.97 |
1.98 |
2.07 |
2.02 |
0.07 |
0.28 |
86.7 |
114.8 |
0.22 |
|
PFOA |
2.00 |
2.08 |
2.16 |
2.11 |
2.00 |
2.03 |
2.06 |
2.04 |
2.07 |
0.05 |
0.21 |
93.1 |
113.7 |
0.16 |
|
PFHpS* |
1.91 |
1.89 |
2.07 |
2.04 |
1.97 |
2.03 |
1.88 |
2.16 |
2.01 |
0.10 |
0.40 |
80.5 |
120.1 |
0.31 |
|
PFNA |
2.00 |
2.15 |
2.22 |
2.10 |
1.96 |
2.04 |
2.00 |
2.08 |
2.08 |
0.09 |
0.34 |
86.8 |
121.0 |
0.27 |
|
PFOS* |
1.86 |
1.99 |
2.00 |
2.02 |
1.92 |
1.88 |
1.88 |
2.04 |
1.96 |
0.07 |
0.27 |
84.4 |
111.8 |
0.22 |
|
9Cl-PF3ONS* |
1.87 |
1.85 |
1.88 |
1.77 |
1.73 |
1.73 |
1.78 |
1.83 |
1.80 |
0.06 |
0.23 |
78.2 |
101.5 |
0.18 |
|
8:2 FTS* |
1.92 |
2.07 |
2.07 |
1.91 |
1.93 |
1.83 |
2.05 |
2.05 |
1.99 |
0.10 |
0.38 |
80.4 |
118.2 |
0.30 |
|
PFDA |
2.00 |
2.04 |
2.15 |
2.06 |
1.96 |
1.97 |
2.03 |
2.04 |
2.04 |
0.06 |
0.26 |
88.9 |
114.7 |
0.20 |
|
PFUnA |
2.00 |
2.07 |
2.05 |
2.11 |
1.99 |
1.98 |
1.98 |
2.08 |
2.04 |
0.05 |
0.21 |
91.2 |
112.6 |
0.17 |
|
11Cl-PF3OUdS* |
1.89 |
1.80 |
1.85 |
1.86 |
1.70 |
1.73 |
1.81 |
1.84 |
1.80 |
0.06 |
0.24 |
78.0 |
101.9 |
0.19 |
|
PFDoA |
2.00 |
2.13 |
2.08 |
2.19 |
1.99 |
2.03 |
2.08 |
2.17 |
2.10 |
0.07 |
0.29 |
90.5 |
119.1 |
0.23 |
*Analytes were used in salt form and calculated concentrations were corrected to compensate where needed.
|
|
Conc. |
1 |
2 |
3 |
4 |
5 |
6 |
7 |
8 |
Average |
Std |
HRPIR |
Lower |
Upper |
DL |
|
(ng/L) (ng/L) (ng/L) (ng/L) (ng/L) (ng/L) (ng/L) (ng/L) (ng/L) (ng/L) |
Dev |
(ng/L) |
PIR |
PIR |
(ng/L) |
||||||||||
|
|
|
|
|
|
|
|
|
|
|
(ng/L) |
|
% |
% |
|
|
|
PFBA |
2.00 |
2.08 |
2.11 |
2.07 |
2.27 |
2.06 |
2.09 |
2.13 |
2.09 |
2.11 |
0.07 |
0.26 |
92.8 |
118.6 |
0.21 |
|
PFMPA |
2.00 |
2.07 |
2.10 |
2.06 |
2.27 |
2.15 |
2.23 |
2.14 |
2.14 |
2.14 |
0.08 |
0.28 |
93.3 |
121.2 |
0.23 |
|
PFPeA |
2.00 |
2.02 |
2.02 |
2.00 |
2.08 |
2.01 |
2.13 |
2.03 |
2.01 |
2.04 |
0.04 |
0.16 |
93.7 |
110.0 |
0.13 |
|
PFBS* |
1.77 |
1.83 |
1.78 |
1.83 |
1.85 |
1.87 |
1.87 |
1.81 |
1.80 |
1.83 |
0.03 |
0.12 |
85.6 |
97.6 |
0.10 |
|
PFMBA |
2.00 |
2.17 |
2.03 |
2.16 |
2.11 |
2.14 |
2.16 |
2.14 |
2.08 |
2.12 |
0.05 |
0.18 |
97.1 |
115.1 |
0.14 |
|
PFEESA* |
1.78 |
1.82 |
1.76 |
1.81 |
1.84 |
1.80 |
1.91 |
1.79 |
1.75 |
1.81 |
0.05 |
0.19 |
80.7 |
100.1 |
0.16 |
|
NFDHA |
2.00 |
2.11 |
1.92 |
1.97 |
2.06 |
2.19 |
2.00 |
2.08 |
(1) |
2.05 |
0.09 |
0.36 |
84.2 |
120.4 |
0.29 |
|
4:2 FTS* |
1.88 |
1.92 |
1.85 |
1.80 |
1.96 |
1.93 |
2.06 |
1.88 |
1.89 |
1.91 |
0.08 |
0.29 |
81.1 |
110.0 |
0.23 |
|
PFHxA |
2.00 |
2.09 |
1.95 |
2.04 |
2.01 |
2.04 |
2.11 |
2.04 |
1.99 |
2.03 |
0.05 |
0.19 |
92.0 |
111.4 |
0.16 |
|
PFPeS* |
1.88 |
1.83 |
1.82 |
1.98 |
1.92 |
1.86 |
1.95 |
1.80 |
1.88 |
1.88 |
0.06 |
0.24 |
82.2 |
105.8 |
0.19 |
|
HFPO-DA |
2.00 |
1.98 |
1.99 |
1.92 |
2.01 |
2.00 |
(1) |
2.31 |
2.15 |
2.05 |
0.13 |
0.52 |
76.4 |
128.7 |
0.41 |
|
PFHpA |
2.00 |
1.94 |
1.91 |
1.94 |
2.00 |
1.93 |
2.10 |
2.06 |
2.05 |
1.99 |
0.07 |
0.27 |
86.1 |
113.0 |
0.22 |
|
PFHxS* |
1.83 |
1.88 |
1.88 |
1.90 |
1.84 |
1.85 |
1.90 |
1.76 |
1.90 |
1.86 |
0.05 |
0.18 |
84.2 |
102.1 |
0.14 |
|
ADONA* |
1.89 |
1.73 |
1.73 |
1.73 |
1.82 |
1.70 |
1.87 |
1.83 |
1.76 |
1.77 |
0.06 |
0.22 |
77.4 |
99.7 |
0.18 |
|
6:2 FTS* |
1.90 |
2.01 |
1.99 |
1.95 |
1.97 |
1.98 |
2.05 |
1.90 |
1.87 |
1.96 |
0.06 |
0.22 |
87.1 |
109.2 |
0.18 |
|
PFOA |
2.00 |
1.97 |
1.96 |
2.01 |
2.03 |
2.00 |
2.08 |
2.00 |
2.06 |
2.01 |
0.04 |
0.15 |
93.2 |
108.1 |
0.12 |
|
PFHpS* |
1.91 |
1.76 |
1.81 |
1.89 |
1.83 |
1.99 |
1.92 |
1.95 |
1.82 |
1.87 |
0.08 |
0.30 |
78.8 |
108.4 |
0.24 |
|
PFNA |
2.00 |
1.97 |
1.97 |
2.11 |
2.10 |
2.05 |
2.11 |
2.07 |
1.98 |
2.04 |
0.06 |
0.23 |
90.5 |
113.9 |
0.19 |
|
PFOS* |
1.86 |
1.86 |
1.81 |
1.82 |
1.95 |
1.86 |
1.89 |
1.94 |
1.95 |
1.89 |
0.06 |
0.22 |
83.5 |
105.1 |
0.17 |
|
9Cl-PF3ONS* |
1.87 |
1.81 |
1.76 |
1.90 |
1.86 |
1.78 |
1.91 |
1.91 |
1.80 |
1.84 |
0.06 |
0.22 |
80.8 |
103.3 |
0.18 |
|
8:2 FTS* |
1.92 |
1.95 |
1.81 |
1.91 |
1.91 |
1.83 |
2.04 |
1.99 |
1.88 |
1.91 |
0.08 |
0.28 |
81.5 |
109.9 |
0.23 |
|
PFDA |
2.00 |
2.11 |
1.98 |
2.05 |
2.02 |
2.00 |
2.10 |
2.09 |
2.04 |
2.05 |
0.05 |
0.18 |
93.8 |
111.3 |
0.14 |
|
PFUnA |
2.00 |
2.01 |
1.94 |
2.02 |
2.08 |
2.00 |
2.08 |
2.10 |
2.07 |
2.04 |
0.05 |
0.20 |
91.8 |
111.9 |
0.16 |
|
11Cl-PF3OUdS* |
1.89 |
1.84 |
1.74 |
1.88 |
1.75 |
1.74 |
1.91 |
1.83 |
1.83 |
1.82 |
0.06 |
0.24 |
78.9 |
102.7 |
0.19 |
|
PFDoA |
2.00 |
2.04 |
2.07 |
2.06 |
2.06 |
2.07 |
2.16 |
2.05 |
2.10 |
2.08 |
0.04 |
0.15 |
96.5 |
111.1 |
0.12 |
*Analytes were used in salt form and calculated concentrations were corrected to compensate where needed.
|
TurboVap® LV |
||||||||
|
Replicate |
1 |
2 |
3 |
4 |
5 |
6 |
7 |
8 |
|
PFBA |
0.07 |
0.00 |
0.00 |
0.03 |
0.03 |
0.00 |
0.03 |
0.04 |
|
PFMPA |
0.01 |
0.01 |
0.01 |
0.01 |
0.01 |
0.01 |
0.01 |
0.01 |
|
PFPeA |
0.06 |
0.04 |
0.04 |
0.05 |
0.05 |
0.06 |
0.06 |
0.05 |
|
PFBS* |
0.00 |
0.02 |
0.01 |
0.01 |
0.02 |
0.01 |
0.01 |
0.02 |
|
PFMBA |
0.01 |
0.01 |
0.01 |
0.00 |
0.01 |
0.02 |
0.01 |
0.01 |
|
PFEESA* |
0.00 |
0.00 |
0.00 |
0.01 |
0.00 |
0.01 |
0.01 |
0.01 |
|
NFDHA |
0.00 |
0.01 |
0.00 |
0.01 |
0.00 |
0.00 |
0.00 |
0.00 |
|
4:2 FTS* |
0.04 |
0.06 |
0.04 |
0.04 |
0.03 |
0.05 |
0.04 |
0.04 |
|
PFHxA |
0.03 |
0.04 |
0.03 |
0.04 |
0.04 |
0.04 |
0.04 |
0.03 |
|
PFPeS* |
0.00 |
0.01 |
0.01 |
0.00 |
0.00 |
0.01 |
0.01 |
0.01 |
|
HFPO-DA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFHpA |
0.02 |
0.02 |
0.04 |
0.03 |
0.04 |
0.04 |
0.03 |
0.03 |
|
PFHxS* |
0.01 |
0.02 |
0.02 |
0.02 |
0.02 |
0.02 |
0.01 |
0.02 |
|
ADONA* |
0.00 |
0.00 |
0.00 |
0.01 |
0.01 |
0.01 |
0.01 |
0.01 |
|
6:2 FTS* |
0.02 |
0.01 |
0.03 |
0.03 |
0.03 |
0.03 |
0.01 |
0.04 |
|
PFOA |
0.07 |
0.05 |
0.04 |
0.05 |
0.00 |
0.08 |
0.05 |
0.05 |
|
PFHpS* |
0.00 |
0.00 |
0.00 |
0.00 |
0.01 |
0.00 |
0.00 |
0.00 |
|
PFNA |
0.02 |
0.02 |
0.03 |
0.03 |
0.02 |
0.02 |
0.03 |
0.02 |
|
PFOS* |
0.04 |
0.06 |
0.03 |
0.04 |
0.04 |
0.05 |
0.06 |
0.05 |
|
9Cl-PF3ONS* |
0.00 |
0.00 |
0.00 |
0.01 |
0.01 |
0.01 |
0.01 |
0.01 |
|
8:2 FTS* |
0.00 |
0.02 |
0.03 |
0.01 |
0.02 |
0.04 |
0.05 |
0.03 |
|
PFDA |
0.02 |
0.05 |
0.02 |
0.04 |
0.04 |
0.03 |
0.03 |
0.03 |
|
PFUnA |
0.01 |
0.01 |
0.01 |
0.02 |
0.02 |
0.03 |
0.02 |
0.02 |
|
11Cl-PF3OUdS* |
0.00 |
0.00 |
0.00 |
0.01 |
0.01 |
0.02 |
0.02 |
0.01 |
|
PFDoA |
0.03 |
0.03 |
0.02 |
0.03 |
0.04 |
0.05 |
0.05 |
0.06 |
*Analytes were used in salt form and calculated concentrations were corrected to compensate where needed.
|
|
200 mg/6 mL |
500 mg/6 mL |
||||||
|
Replicate |
1 |
2 |
3 |
4 |
1 |
2 |
3 |
4 |
|
PFBA |
0.04 |
0.06 |
0.06 |
0.06 |
0.10 |
0.08 |
0.08 |
0.08 |
|
PFMPA |
0.01 |
0.01 |
0.01 |
0.01 |
0.01 |
0.01 |
0.00 |
0.01 |
|
PFPeA |
0.05 |
0.05 |
0.05 |
0.05 |
0.05 |
0.05 |
0.06 |
0.05 |
|
PFBS* |
0.02 |
0.02 |
0.02 |
0.03 |
0.04 |
0.02 |
0.02 |
0.02 |
|
PFMBA |
0.01 |
0.01 |
0.01 |
0.00 |
0.01 |
0.01 |
0.00 |
0.01 |
|
PFEESA* |
0.01 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
NFDHA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.02 |
0.01 |
0.00 |
|
4:2 FTS* |
0.04 |
0.06 |
0.04 |
0.04 |
0.04 |
0.07 |
0.04 |
0.05 |
|
PFHxA |
0.05 |
0.04 |
0.04 |
0.03 |
0.05 |
0.04 |
0.05 |
0.05 |
|
PFPeS* |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
HFPO-DA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFHpA |
0.04 |
0.03 |
0.03 |
0.04 |
0.04 |
0.03 |
0.02 |
0.04 |
|
PFHxS* |
0.02 |
0.02 |
0.02 |
0.02 |
0.02 |
0.01 |
0.02 |
0.02 |
|
ADONA* |
0.00 |
0.01 |
0.01 |
0.01 |
0.01 |
0.00 |
0.00 |
0.00 |
|
6:2 FTS* |
0.06 |
0.10 |
0.07 |
0.08 |
0.06 |
0.06 |
0.04 |
0.06 |
|
PFOA |
0.04 |
0.07 |
0.06 |
0.05 |
0.06 |
0.05 |
0.05 |
0.05 |
|
PFHpS* |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFNA |
0.02 |
0.02 |
0.03 |
0.02 |
0.02 |
0.02 |
0.02 |
0.03 |
|
PFOS* |
0.02 |
0.04 |
0.05 |
0.03 |
0.05 |
0.04 |
0.03 |
0.05 |
|
9Cl-PF3ONS* |
0.00 |
0.00 |
0.00 |
0.00 |
0.01 |
0.01 |
0.00 |
0.01 |
|
8:2 FTS* |
0.00 |
0.02 |
0.03 |
0.03 |
0.03 |
0.01 |
0.02 |
0.02 |
|
PFDA |
0.02 |
0.03 |
0.03 |
0.02 |
0.03 |
0.03 |
0.04 |
0.03 |
|
PFUnA |
0.01 |
0.02 |
0.02 |
0.02 |
0.02 |
0.02 |
0.02 |
0.02 |
|
11Cl-PF3OUdS* |
0.01 |
0.01 |
0.00 |
0.01 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFDoA |
0.04 |
0.04 |
0.04 |
0.05 |
0.04 |
0.03 |
0.02 |
0.03 |
*Analytes were used in salt form and calculated concentrations were corrected to compensate where needed.
|
Replicate |
1 |
2 |
3 |
4 |
Average |
Std Dev |
RSD |
|
|
(%) |
(%) |
(%) |
(%) |
(%) |
(%) |
(%) |
|
PFBA |
105.4 |
103.9 |
103.4 |
104.4 |
104.3 |
0.8 |
0.8 |
|
PFMPA |
105.4 |
102.3 |
102.9 |
103.4 |
103.5 |
1.4 |
1.3 |
|
PFPeA |
105.8 |
103.4 |
102.7 |
104.5 |
104.1 |
1.3 |
1.3 |
|
PFBS* |
107.7 |
103.6 |
105.0 |
102.7 |
104.8 |
2.2 |
2.1 |
|
PFMBA |
113.7 |
110.0 |
110.0 |
110.8 |
111.1 |
1.8 |
1.6 |
|
PFEESA* |
103.8 |
101.1 |
100.2 |
98.8 |
101.0 |
2.1 |
2.1 |
|
NFDHA |
108.1 |
99.9 |
111.0 |
108.3 |
106.8 |
4.8 |
4.5 |
|
4:2 FTS* |
106.4 |
104.7 |
107.1 |
106.1 |
106.1 |
1.0 |
0.9 |
|
PFHxA |
106.3 |
104.6 |
105.4 |
106.2 |
105.7 |
0.8 |
0.7 |
|
PFPeS* |
104.0 |
102.4 |
100.8 |
105.4 |
103.2 |
2.0 |
1.9 |
|
HFPO-DA |
105.4 |
100.4 |
107.2 |
102.3 |
103.9 |
3.0 |
2.9 |
|
PFHpA |
101.7 |
99.7 |
99.6 |
98.7 |
99.9 |
1.3 |
1.3 |
|
PFHxS* |
107.0 |
104.9 |
104.6 |
104.5 |
105.2 |
1.2 |
1.1 |
|
ADONA* |
97.4 |
94.3 |
94.8 |
92.4 |
94.7 |
2.1 |
2.2 |
|
6:2 FTS* |
104.6 |
104.1 |
103.1 |
101.8 |
103.4 |
1.2 |
1.2 |
|
PFOA |
104.7 |
100.2 |
102.7 |
102.0 |
102.4 |
1.9 |
1.8 |
|
PFHpS* |
105.2 |
104.9 |
101.7 |
105.0 |
104.2 |
1.7 |
1.6 |
|
PFNA |
105.1 |
102.8 |
104.0 |
105.1 |
104.2 |
1.1 |
1.0 |
|
PFOS* |
104.6 |
101.5 |
104.4 |
102.4 |
103.2 |
1.5 |
1.4 |
|
9Cl-PF3ONS* |
98.4 |
95.4 |
95.3 |
96.1 |
96.3 |
1.4 |
1.5 |
|
8:2 FTS* |
106.6 |
107.1 |
105.1 |
105.8 |
106.2 |
0.9 |
0.8 |
|
PFDA |
100.7 |
99.2 |
100.5 |
104.0 |
101.1 |
2.1 |
2.0 |
|
PFUnA |
103.8 |
103.1 |
101.2 |
101.0 |
102.3 |
1.4 |
1.4 |
|
11Cl-PF3OUdS* |
99.4 |
98.3 |
97.6 |
96.5 |
97.9 |
1.2 |
1.2 |
|
PFDoA |
105.4 |
104.2 |
101.4 |
102.7 |
103.4 |
1.8 |
1.7 |
|
Replicate |
1 |
2 |
3 |
4 |
Average |
Std Dev |
RSD |
|
|
(%) |
(%) |
(%) |
(%) |
(%) |
(%) |
(%) |
|
PFBA |
106.6 |
104.8 |
101.5 |
100.5 |
103.3 |
2.8 |
2.8 |
|
PFMPA |
107.0 |
103.8 |
97.2 |
99.0 |
101.7 |
4.5 |
4.4 |
|
PFPeA |
102.6 |
100.8 |
101.6 |
94.5 |
99.9 |
3.7 |
3.7 |
|
PFBS* |
104.4 |
102.4 |
103.3 |
99.8 |
102.5 |
2.0 |
1.9 |
|
PFMBA |
111.2 |
109.2 |
105.0 |
104.1 |
107.4 |
3.4 |
3.1 |
|
PFEESA* |
103.8 |
101.5 |
100.5 |
98.6 |
101.1 |
2.1 |
2.1 |
|
NFDHA |
98.9 |
103.7 |
118.6 |
101.4 |
105.7 |
8.8 |
8.4 |
|
4:2 FTS* |
102.4 |
101.6 |
97.9 |
99.1 |
100.2 |
2.1 |
2.1 |
|
PFHxA |
103.6 |
103.0 |
100.5 |
99.9 |
101.7 |
1.8 |
1.8 |
|
PFPeS* |
100.9 |
100.2 |
103.7 |
99.3 |
101.0 |
1.9 |
1.9 |
|
HFPO-DA |
101.3 |
105.6 |
110.6 |
97.2 |
103.7 |
5.7 |
5.5 |
|
PFHpA |
97.4 |
97.3 |
98.8 |
94.1 |
96.9 |
2.0 |
2.0 |
|
PFHxS* |
102.8 |
102.2 |
102.5 |
96.6 |
101.0 |
2.9 |
2.9 |
|
ADONA* |
98.3 |
98.6 |
98.5 |
91.2 |
96.7 |
3.7 |
3.8 |
|
6:2 FTS* |
103.2 |
102.8 |
99.7 |
99.0 |
101.2 |
2.1 |
2.1 |
|
PFOA |
100.1 |
98.9 |
98.5 |
96.8 |
98.6 |
1.3 |
1.4 |
|
PFHpS* |
100.1 |
101.8 |
107.0 |
99.9 |
102.2 |
3.3 |
3.2 |
|
PFNA |
109.6 |
105.4 |
103.6 |
100.2 |
104.7 |
3.9 |
3.7 |
|
PFOS* |
101.8 |
99.8 |
97.3 |
99.2 |
99.5 |
1.8 |
1.9 |
|
9Cl-PF3ONS* |
102.6 |
99.1 |
92.0 |
95.6 |
97.3 |
4.6 |
4.7 |
|
8:2 FTS* |
101.5 |
97.3 |
96.2 |
91.6 |
96.7 |
4.1 |
4.2 |
|
PFDA |
101.0 |
98.0 |
96.8 |
98.4 |
98.5 |
1.8 |
1.8 |
|
PFUnA |
99.4 |
96.9 |
96.1 |
98.6 |
97.8 |
1.5 |
1.5 |
|
11Cl-PF3OUdS* |
100.8 |
98.0 |
95.0 |
94.4 |
97.1 |
3.0 |
3.0 |
|
PFDoA |
103.6 |
101.1 |
100.9 |
98.1 |
100.9 |
2.2 |
2.2 |
|
Replicate |
1 |
2 |
3 |
4 |
Average |
|
|
(ng/L) |
(ng/L) |
(ng/L) |
(ng/L) |
(ng/L) |
|
PFBA |
0.07 |
0.09 |
0.08 |
0.10 |
0.08 |
|
PFMPA |
0.01 |
0.00 |
0.01 |
0.01 |
0.01 |
|
PFPeA |
0.05 |
0.05 |
0.06 |
0.05 |
0.05 |
|
PFBS* |
0.02 |
0.02 |
0.02 |
0.01 |
0.02 |
|
PFMBA |
0.00 |
0.01 |
0.01 |
0.00 |
0.00 |
|
PFEESA* |
0.00 |
0.00 |
0.00 |
0.01 |
0.00 |
|
NFDHA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
4:2 FTS* |
0.04 |
0.06 |
0.04 |
0.04 |
0.05 |
|
PFHxA |
0.03 |
0.04 |
0.02 |
0.03 |
0.03 |
|
PFPeS* |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
HFPO-DA |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFHpA |
0.03 |
0.03 |
0.04 |
0.03 |
0.03 |
|
PFHxS* |
0.02 |
0.01 |
0.02 |
0.01 |
0.02 |
|
ADONA* |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
6:2 FTS* |
0.04 |
0.06 |
0.04 |
0.03 |
0.04 |
|
PFOA |
0.07 |
0.06 |
0.09 |
0.05 |
0.07 |
|
PFHpS* |
0.00 |
0.00 |
0.00 |
0.00 |
0.00 |
|
PFNA |
0.04 |
0.02 |
0.03 |
0.03 |
0.03 |
|
PFOS* |
0.05 |
0.06 |
0.05 |
0.05 |
0.05 |
|
9Cl-PF3ONS* |
0.01 |
0.01 |
0.00 |
0.01 |
0.01 |
|
8:2 FTS* |
0.02 |
0.02 |
0.02 |
0.02 |
0.02 |
|
PFDA |
0.04 |
0.03 |
0.04 |
0.02 |
0.03 |
|
PFUnA |
0.02 |
0.04 |
0.03 |
0.01 |
0.03 |
|
11Cl-PF3OUdS* |
0.02 |
0.01 |
0.00 |
0.00 |
0.01 |
|
PFDoA |
0.05 |
0.05 |
0.04 |
0.04 |
0.04 |
Literature number: AN972